C26H48O5Si — CID 10096197
(E,2S,3R,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,8,10-pentamethyl-12-methylidene-9-oxotetradec-6-enoic acid (PubChem CID 10096197) has the molecular formula C26H48O5Si and a molecular weight of 468.75 g/mol. Its IUPAC name is (E,2S,3R,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,8,10-pentamethyl-12-methylidene-9-oxotetradec-6-enoic acid.
| Compound Name | (E,2S,3R,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,8,10-pentamethyl-12-methylidene-9-oxotetradec-6-enoic acid |
|---|---|
| PubChem CID | 10096197 |
| Molecular Formula | C26H48O5Si |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | (E,2S,3R,4S,8R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,8,10-pentamethyl-12-methylidene-9-oxotetradec-6-enoic acid |
| SMILES | C=C(CC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)[C@H](C)/C=C(\C)C[C@H](C)[C@@H](O)[C@H](C)C(=O)O |
| InChI | InChI=1S/C26H48O5Si/c1-13-17(3)24(31-32(11,12)26(8,9)10)20(6)22(27)18(4)14-16(2)15-19(5)23(28)21(7)25(29)30/h14,18-21,23-24,28H,3,13,15H2,1-2,4-12H3,(H,29,30)/b16-14+/t18-,19+,20-,21+,23-,24-/m1/s1 |
| InChIKey | LAHDMSWKSYYCIY-FJKSSUFISA-N |
| XLogP | 6.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|