C7H13NO4 — CID 100962703
(1S,2S,3R)-6-amino-4-[hydroxy(tritio)methyl]cyclohex-4-ene-1,2,3-triol (PubChem CID 100962703) has the molecular formula C7H13NO4 and a molecular weight of 177.19 g/mol. Its IUPAC name is (1S,2S,3R)-6-amino-4-[hydroxy(tritio)methyl]cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2S,3R)-6-amino-4-[hydroxy(tritio)methyl]cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 100962703 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | (1S,2S,3R)-6-amino-4-[hydroxy(tritio)methyl]cyclohex-4-ene-1,2,3-triol |
| SMILES | [3H]C(O)C1=CC(N)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H13NO4/c8-4-1-3(2-9)5(10)7(12)6(4)11/h1,4-7,9-12H,2,8H2/t4?,5-,6+,7+/m1/s1/i2T/t2?,4?,5-,6+,7+ |
| InChIKey | XPHOBMULWMGEBA-WMHRNPNOSA-N |
| XLogP | -2.67 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|