C13H25NO9 — CID 13076039
(2R,3S,4R,5S)-6-[[(1S,4R,5R,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]hexane-1,2,3,4,5-pentol (PubChem CID 13076039) has the molecular formula C13H25NO9 and a molecular weight of 339.34 g/mol. Its IUPAC name is (2R,3S,4R,5S)-6-[[(1S,4R,5R,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3S,4R,5S)-6-[[(1S,4R,5R,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 13076039 |
| Molecular Formula | C13H25NO9 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (2R,3S,4R,5S)-6-[[(1S,4R,5R,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)cyclohex-2-en-1-yl]amino]hexane-1,2,3,4,5-pentol |
| SMILES | OCC1=C[C@H](NC[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H25NO9/c15-3-5-1-6(10(20)13(23)9(5)19)14-2-7(17)11(21)12(22)8(18)4-16/h1,6-23H,2-4H2/t6-,7-,8+,9+,10-,11+,12-,13+/m0/s1 |
| InChIKey | BHRLDBKJRVKLRY-BFQKYARKSA-N |
| XLogP | -5.60 |
| TPSA | 194.10 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | -5.60 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|