C14H19NO6 — CID 13364640
6-[(3,4-dihydroxyphenyl)methylamino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 13364640) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is 6-[(3,4-dihydroxyphenyl)methylamino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | 6-[(3,4-dihydroxyphenyl)methylamino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 13364640 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 6-[(3,4-dihydroxyphenyl)methylamino]-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | OCC1=CC(NCc2ccc(O)c(O)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C14H19NO6/c16-6-8-4-9(13(20)14(21)12(8)19)15-5-7-1-2-10(17)11(18)3-7/h1-4,9,12-21H,5-6H2 |
| InChIKey | XIZSZRAEEGPNKJ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 133.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|