C8H12N4O2 — CID 100963390
(2S)-2-amino-4-(6-aminopyrimidin-4-yl)butanoic acid (PubChem CID 100963390) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is (2S)-2-amino-4-(6-aminopyrimidin-4-yl)butanoic acid.
| Compound Name | (2S)-2-amino-4-(6-aminopyrimidin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 100963390 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (2S)-2-amino-4-(6-aminopyrimidin-4-yl)butanoic acid |
| SMILES | Nc1cc(CC[C@H](N)C(=O)O)ncn1 |
| InChI | InChI=1S/C8H12N4O2/c9-6(8(13)14)2-1-5-3-7(10)12-4-11-5/h3-4,6H,1-2,9H2,(H,13,14)(H2,10,11,12)/t6-/m0/s1 |
| InChIKey | BXEXGCKCUVQJML-LURJTMIESA-N |
| XLogP | -0.60 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |