C24H15N3O4S — CID 100963604
7-(benzenesulfonyl)-3-(1H-indol-3-yl)-1H-pyrrolo[3,2-f]indole-4,8-dione (PubChem CID 100963604) has the molecular formula C24H15N3O4S and a molecular weight of 441.47 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-3-(1H-indol-3-yl)-1H-pyrrolo[3,2-f]indole-4,8-dione.
| Compound Name | 7-(benzenesulfonyl)-3-(1H-indol-3-yl)-1H-pyrrolo[3,2-f]indole-4,8-dione |
|---|---|
| PubChem CID | 100963604 |
| Molecular Formula | C24H15N3O4S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 7-(benzenesulfonyl)-3-(1H-indol-3-yl)-1H-pyrrolo[3,2-f]indole-4,8-dione |
| SMILES | O=C1c2ccn(S(=O)(=O)c3ccccc3)c2C(=O)c2[nH]cc(-c3c[nH]c4ccccc34)c21 |
| InChI | InChI=1S/C24H15N3O4S/c28-23-16-10-11-27(32(30,31)14-6-2-1-3-7-14)22(16)24(29)21-20(23)18(13-26-21)17-12-25-19-9-5-4-8-15(17)19/h1-13,25-26H |
| InChIKey | NCXYJRIJZMGWPZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|