C17H13ClN4O3 — CID 100964485
(2aS,8R,8aR)-8-azido-6-chloro-1-(4-methoxyphenyl)-8,8a-dihydro-2aH-chromeno[3,2-b]azet-2-one (PubChem CID 100964485) has the molecular formula C17H13ClN4O3 and a molecular weight of 356.77 g/mol. Its IUPAC name is (2aS,8R,8aR)-8-azido-6-chloro-1-(4-methoxyphenyl)-8,8a-dihydro-2aH-chromeno[3,2-b]azet-2-one.
| Compound Name | (2aS,8R,8aR)-8-azido-6-chloro-1-(4-methoxyphenyl)-8,8a-dihydro-2aH-chromeno[3,2-b]azet-2-one |
|---|---|
| PubChem CID | 100964485 |
| Molecular Formula | C17H13ClN4O3 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (2aS,8R,8aR)-8-azido-6-chloro-1-(4-methoxyphenyl)-8,8a-dihydro-2aH-chromeno[3,2-b]azet-2-one |
| SMILES | COc1ccc(N2C(=O)[C@H]3Oc4ccc(Cl)cc4[C@@H](N=[N+]=[N-])[C@H]32)cc1 |
| InChI | InChI=1S/C17H13ClN4O3/c1-24-11-5-3-10(4-6-11)22-15-14(20-21-19)12-8-9(18)2-7-13(12)25-16(15)17(22)23/h2-8,14-16H,1H3/t14-,15-,16+/m1/s1 |
| InChIKey | KXNHOASPEHBGNU-OAGGEKHMSA-N |
| XLogP | 3.88 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|