C16H13Cl2NO2S — CID 4248077
2-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 4248077) has the molecular formula C16H13Cl2NO2S and a molecular weight of 354.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4248077 |
| Molecular Formula | C16H13Cl2NO2S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)CSC2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H13Cl2NO2S/c1-21-12-5-3-11(4-6-12)19-15(20)9-22-16(19)13-7-2-10(17)8-14(13)18/h2-8,16H,9H2,1H3 |
| InChIKey | SOWUEVAHMLKQDY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |