C19H15ClN2O2S — CID 11100740
2-(2-chloroquinolin-3-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 11100740) has the molecular formula C19H15ClN2O2S and a molecular weight of 370.86 g/mol. Its IUPAC name is 2-(2-chloroquinolin-3-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(2-chloroquinolin-3-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 11100740 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2-(2-chloroquinolin-3-yl)-3-(4-methoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)CSC2c2cc3ccccc3nc2Cl)cc1 |
| InChI | InChI=1S/C19H15ClN2O2S/c1-24-14-8-6-13(7-9-14)22-17(23)11-25-19(22)15-10-12-4-2-3-5-16(12)21-18(15)20/h2-10,19H,11H2,1H3 |
| InChIKey | UGEOETXSOIWFMI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|