C20H17ClN2O3S — CID 10692406
2-(2-chloro-7-methoxyquinolin-3-yl)-3-(2-methoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 10692406) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is 2-(2-chloro-7-methoxyquinolin-3-yl)-3-(2-methoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(2-chloro-7-methoxyquinolin-3-yl)-3-(2-methoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10692406 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2-(2-chloro-7-methoxyquinolin-3-yl)-3-(2-methoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2cc(C3SCC(=O)N3c3ccccc3OC)c(Cl)nc2c1 |
| InChI | InChI=1S/C20H17ClN2O3S/c1-25-13-8-7-12-9-14(19(21)22-15(12)10-13)20-23(18(24)11-27-20)16-5-3-4-6-17(16)26-2/h3-10,20H,11H2,1-2H3 |
| InChIKey | WTZUCVNOTLAJKM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|