C17H18N2O3S — CID 42803990
2-(4-aminophenyl)-3-(2,5-dimethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 42803990) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(4-aminophenyl)-3-(2,5-dimethoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(4-aminophenyl)-3-(2,5-dimethoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 42803990 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-(4-aminophenyl)-3-(2,5-dimethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(OC)c(N2C(=O)CSC2c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C17H18N2O3S/c1-21-13-7-8-15(22-2)14(9-13)19-16(20)10-23-17(19)11-3-5-12(18)6-4-11/h3-9,17H,10,18H2,1-2H3 |
| InChIKey | IJJXWDZKJXRSDD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|