C26H21ClN4O3S — CID 135954811
2-(2-chloro-7-methoxyquinolin-3-yl)-3-[5-hydroxy-2-[(4-methylphenyl)diazenyl]phenyl]-1,3-thiazolidin-4-one (PubChem CID 135954811) has the molecular formula C26H21ClN4O3S and a molecular weight of 505.00 g/mol. Its IUPAC name is 2-(2-chloro-7-methoxyquinolin-3-yl)-3-[5-hydroxy-2-[(4-methylphenyl)diazenyl]phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-(2-chloro-7-methoxyquinolin-3-yl)-3-[5-hydroxy-2-[(4-methylphenyl)diazenyl]phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135954811 |
| Molecular Formula | C26H21ClN4O3S |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-(2-chloro-7-methoxyquinolin-3-yl)-3-[5-hydroxy-2-[(4-methylphenyl)diazenyl]phenyl]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2cc(C3SCC(=O)N3c3cc(O)ccc3/N=N\c3ccc(C)cc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C26H21ClN4O3S/c1-15-3-6-17(7-4-15)29-30-21-10-8-18(32)12-23(21)31-24(33)14-35-26(31)20-11-16-5-9-19(34-2)13-22(16)28-25(20)27/h3-13,26,32H,14H2,1-2H3/b30-29- |
| InChIKey | BULZOJGSXKKDCF-FLWNBWAVSA-N |
| XLogP | 7.10 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|