C21H16ClN3O2S2 — CID 52921088
2-(2-chloroquinolin-3-yl)-3-(6-methoxy-1,3-benzothiazol-2-yl)-5-methyl-1,3-thiazolidin-4-one (PubChem CID 52921088) has the molecular formula C21H16ClN3O2S2 and a molecular weight of 441.97 g/mol. Its IUPAC name is 2-(2-chloroquinolin-3-yl)-3-(6-methoxy-1,3-benzothiazol-2-yl)-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(2-chloroquinolin-3-yl)-3-(6-methoxy-1,3-benzothiazol-2-yl)-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 52921088 |
| Molecular Formula | C21H16ClN3O2S2 |
| Molecular Weight | 441.97 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 2-(2-chloroquinolin-3-yl)-3-(6-methoxy-1,3-benzothiazol-2-yl)-5-methyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2nc(N3C(=O)C(C)SC3c3cc4ccccc4nc3Cl)sc2c1 |
| InChI | InChI=1S/C21H16ClN3O2S2/c1-11-19(26)25(21-24-16-8-7-13(27-2)10-17(16)29-21)20(28-11)14-9-12-5-3-4-6-15(12)23-18(14)22/h3-11,20H,1-2H3 |
| InChIKey | FKWLZDXJCPXENY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.97 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|