C22H19ClN2O3S — CID 11080448
ethyl 4-[2-(2-chloroquinolin-3-yl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]benzoate (PubChem CID 11080448) has the molecular formula C22H19ClN2O3S and a molecular weight of 426.93 g/mol. Its IUPAC name is ethyl 4-[2-(2-chloroquinolin-3-yl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | ethyl 4-[2-(2-chloroquinolin-3-yl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 11080448 |
| Molecular Formula | C22H19ClN2O3S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | ethyl 4-[2-(2-chloroquinolin-3-yl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(C)SC2c2cc3ccccc3nc2Cl)cc1 |
| InChI | InChI=1S/C22H19ClN2O3S/c1-3-28-22(27)14-8-10-16(11-9-14)25-20(26)13(2)29-21(25)17-12-15-6-4-5-7-18(15)24-19(17)23/h4-13,21H,3H2,1-2H3 |
| InChIKey | AWPPPXOUXGUHDV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|