C20H15ClN2O5 — CID 7707410
ethyl 4-[(3aR,6aS)-3-(2-chlorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate (PubChem CID 7707410) has the molecular formula C20H15ClN2O5 and a molecular weight of 398.80 g/mol. Its IUPAC name is ethyl 4-[(3aR,6aS)-3-(2-chlorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate.
| Compound Name | ethyl 4-[(3aR,6aS)-3-(2-chlorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 7707410 |
| Molecular Formula | C20H15ClN2O5 |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | ethyl 4-[(3aR,6aS)-3-(2-chlorophenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazol-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3C(c4ccccc4Cl)=NO[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C20H15ClN2O5/c1-2-27-20(26)11-7-9-12(10-8-11)23-18(24)15-16(22-28-17(15)19(23)25)13-5-3-4-6-14(13)21/h3-10,15,17H,2H2,1H3/t15-,17+/m1/s1 |
| InChIKey | XHJLRDJHRLTIKP-WBVHZDCISA-N |
| XLogP | 2.81 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|