C22H14Cl3N3O3S2 — CID 10929578
3,5-dichloro-N-[2-(2-chloro-6-methoxyquinolin-3-yl)-4-oxo-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide (PubChem CID 10929578) has the molecular formula C22H14Cl3N3O3S2 and a molecular weight of 538.87 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-(2-chloro-6-methoxyquinolin-3-yl)-4-oxo-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,5-dichloro-N-[2-(2-chloro-6-methoxyquinolin-3-yl)-4-oxo-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 10929578 |
| Molecular Formula | C22H14Cl3N3O3S2 |
| Molecular Weight | 538.87 g/mol |
| Exact Mass | 536.95 |
| IUPAC Name | 3,5-dichloro-N-[2-(2-chloro-6-methoxyquinolin-3-yl)-4-oxo-1,3-thiazolidin-3-yl]-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc2nc(Cl)c(C3SCC(=O)N3NC(=O)c3sc4ccc(Cl)cc4c3Cl)cc2c1 |
| InChI | InChI=1S/C22H14Cl3N3O3S2/c1-31-12-3-4-15-10(6-12)7-14(20(25)26-15)22-28(17(29)9-32-22)27-21(30)19-18(24)13-8-11(23)2-5-16(13)33-19/h2-8,22H,9H2,1H3,(H,27,30) |
| InChIKey | JMDWNDXDUJBOFN-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.87 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|