C19H13Cl3N2O2S — CID 10252653
2-(2-chloro-7-methoxyquinolin-3-yl)-3-(2,6-dichlorophenyl)-1,3-thiazolidin-4-one (PubChem CID 10252653) has the molecular formula C19H13Cl3N2O2S and a molecular weight of 439.75 g/mol. Its IUPAC name is 2-(2-chloro-7-methoxyquinolin-3-yl)-3-(2,6-dichlorophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(2-chloro-7-methoxyquinolin-3-yl)-3-(2,6-dichlorophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10252653 |
| Molecular Formula | C19H13Cl3N2O2S |
| Molecular Weight | 439.75 g/mol |
| Exact Mass | 437.98 |
| IUPAC Name | 2-(2-chloro-7-methoxyquinolin-3-yl)-3-(2,6-dichlorophenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2cc(C3SCC(=O)N3c3c(Cl)cccc3Cl)c(Cl)nc2c1 |
| InChI | InChI=1S/C19H13Cl3N2O2S/c1-26-11-6-5-10-7-12(18(22)23-15(10)8-11)19-24(16(25)9-27-19)17-13(20)3-2-4-14(17)21/h2-8,19H,9H2,1H3 |
| InChIKey | GPBGIYPDUCJXCQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.75 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|