C19H13Cl3N2O4S — CID 11059772
3,5-dichloro-N-[3-chloro-2-(4-hydroxy-3-methoxyphenyl)-4-oxoazetidin-1-yl]-1-benzothiophene-2-carboxamide (PubChem CID 11059772) has the molecular formula C19H13Cl3N2O4S and a molecular weight of 471.75 g/mol. Its IUPAC name is 3,5-dichloro-N-[3-chloro-2-(4-hydroxy-3-methoxyphenyl)-4-oxoazetidin-1-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,5-dichloro-N-[3-chloro-2-(4-hydroxy-3-methoxyphenyl)-4-oxoazetidin-1-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 11059772 |
| Molecular Formula | C19H13Cl3N2O4S |
| Molecular Weight | 471.75 g/mol |
| Exact Mass | 469.97 |
| IUPAC Name | 3,5-dichloro-N-[3-chloro-2-(4-hydroxy-3-methoxyphenyl)-4-oxoazetidin-1-yl]-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc(C2C(Cl)C(=O)N2NC(=O)c2sc3ccc(Cl)cc3c2Cl)ccc1O |
| InChI | InChI=1S/C19H13Cl3N2O4S/c1-28-12-6-8(2-4-11(12)25)16-15(22)19(27)24(16)23-18(26)17-14(21)10-7-9(20)3-5-13(10)29-17/h2-7,15-16,25H,1H3,(H,23,26) |
| InChIKey | RAZATMREHQFCGX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.75 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|