C19H19ClN2O5 — CID 3794828
N-(3-chloro-2-oxo-4-phenylazetidin-1-yl)-3,4,5-trimethoxybenzamide (PubChem CID 3794828) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is N-(3-chloro-2-oxo-4-phenylazetidin-1-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(3-chloro-2-oxo-4-phenylazetidin-1-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3794828 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N-(3-chloro-2-oxo-4-phenylazetidin-1-yl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NN2C(=O)C(Cl)C2c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19ClN2O5/c1-25-13-9-12(10-14(26-2)17(13)27-3)18(23)21-22-16(15(20)19(22)24)11-7-5-4-6-8-11/h4-10,15-16H,1-3H3,(H,21,23) |
| InChIKey | UVQTXWFUVDAKBC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|