C17H14N4O7S — CID 15272755
N-[2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]-3,5-dinitrobenzamide (PubChem CID 15272755) has the molecular formula C17H14N4O7S and a molecular weight of 418.39 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 15272755 |
| Molecular Formula | C17H14N4O7S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-4-oxo-1,3-thiazolidin-3-yl]-3,5-dinitrobenzamide |
| SMILES | COc1ccc(C2SCC(=O)N2NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H14N4O7S/c1-28-14-4-2-10(3-5-14)17-19(15(22)9-29-17)18-16(23)11-6-12(20(24)25)8-13(7-11)21(26)27/h2-8,17H,9H2,1H3,(H,18,23) |
| InChIKey | MOPRBODEBVTUIO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|