C19H17N3O7S — CID 10741329
methyl 2-[2-[3-[(3-nitrobenzoyl)amino]-4-oxo-1,3-thiazolidin-2-yl]phenoxy]acetate (PubChem CID 10741329) has the molecular formula C19H17N3O7S and a molecular weight of 431.43 g/mol. Its IUPAC name is methyl 2-[2-[3-[(3-nitrobenzoyl)amino]-4-oxo-1,3-thiazolidin-2-yl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[3-[(3-nitrobenzoyl)amino]-4-oxo-1,3-thiazolidin-2-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 10741329 |
| Molecular Formula | C19H17N3O7S |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | methyl 2-[2-[3-[(3-nitrobenzoyl)amino]-4-oxo-1,3-thiazolidin-2-yl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1C1SCC(=O)N1NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17N3O7S/c1-28-17(24)10-29-15-8-3-2-7-14(15)19-21(16(23)11-30-19)20-18(25)12-5-4-6-13(9-12)22(26)27/h2-9,19H,10-11H2,1H3,(H,20,25) |
| InChIKey | IDBQDRNDHGGKSW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|