C15H12Br2N4O4S — CID 71452206
4,5-dibromo-1-methyl-N-[2-(4-nitrophenyl)-4-oxo-1,3-thiazolidin-3-yl]pyrrole-2-carboxamide (PubChem CID 71452206) has the molecular formula C15H12Br2N4O4S and a molecular weight of 504.16 g/mol. Its IUPAC name is 4,5-dibromo-1-methyl-N-[2-(4-nitrophenyl)-4-oxo-1,3-thiazolidin-3-yl]pyrrole-2-carboxamide.
| Compound Name | 4,5-dibromo-1-methyl-N-[2-(4-nitrophenyl)-4-oxo-1,3-thiazolidin-3-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71452206 |
| Molecular Formula | C15H12Br2N4O4S |
| Molecular Weight | 504.16 g/mol |
| Exact Mass | 501.89 |
| IUPAC Name | 4,5-dibromo-1-methyl-N-[2-(4-nitrophenyl)-4-oxo-1,3-thiazolidin-3-yl]pyrrole-2-carboxamide |
| SMILES | Cn1c(C(=O)NN2C(=O)CSC2c2ccc([N+](=O)[O-])cc2)cc(Br)c1Br |
| InChI | InChI=1S/C15H12Br2N4O4S/c1-19-11(6-10(16)13(19)17)14(23)18-20-12(22)7-26-15(20)8-2-4-9(5-3-8)21(24)25/h2-6,15H,7H2,1H3,(H,18,23) |
| InChIKey | PBSWZTLIUZAYDL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|