C15H10Cl2N2O3S — CID 126476201
3-(3,5-dichlorophenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one (PubChem CID 126476201) has the molecular formula C15H10Cl2N2O3S and a molecular weight of 369.23 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(3,5-dichlorophenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126476201 |
| Molecular Formula | C15H10Cl2N2O3S |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-2-(4-nitrophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc([N+](=O)[O-])cc2)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H10Cl2N2O3S/c16-10-5-11(17)7-13(6-10)18-14(20)8-23-15(18)9-1-3-12(4-2-9)19(21)22/h1-7,15H,8H2 |
| InChIKey | HSWGYZASJSPXOC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|