C9H8N2O3S2 — CID 141361496
3-(4-nitrophenyl)-2-sulfanyl-1,3-thiazolidin-4-one (PubChem CID 141361496) has the molecular formula C9H8N2O3S2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-(4-nitrophenyl)-2-sulfanyl-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-nitrophenyl)-2-sulfanyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 141361496 |
| Molecular Formula | C9H8N2O3S2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 3-(4-nitrophenyl)-2-sulfanyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(S)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H8N2O3S2/c12-8-5-16-9(15)10(8)6-1-3-7(4-2-6)11(13)14/h1-4,9,15H,5H2 |
| InChIKey | CWITVRCDRMRDPC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|