C22H19N3O4S — CID 139235926
2-[2-hydroxy-5-[(4-methoxyphenyl)diazenyl]phenyl]-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 139235926) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-[2-hydroxy-5-[(4-methoxyphenyl)diazenyl]phenyl]-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[2-hydroxy-5-[(4-methoxyphenyl)diazenyl]phenyl]-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 139235926 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-[2-hydroxy-5-[(4-methoxyphenyl)diazenyl]phenyl]-3-(4-hydroxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/N=N/c2ccc(O)c(C3SCC(=O)N3c3ccc(O)cc3)c2)cc1 |
| InChI | InChI=1S/C22H19N3O4S/c1-29-18-9-2-14(3-10-18)23-24-15-4-11-20(27)19(12-15)22-25(21(28)13-30-22)16-5-7-17(26)8-6-16/h2-12,22,26-27H,13H2,1H3/b24-23+ |
| InChIKey | MQYRHXAELMUMQA-WCWDXBQESA-N |
| XLogP | 5.30 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|