C15H10Cl2FNOS — CID 5129440
2-(2,4-dichlorophenyl)-3-(2-fluorophenyl)-1,3-thiazolidin-4-one (PubChem CID 5129440) has the molecular formula C15H10Cl2FNOS and a molecular weight of 342.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-(2-fluorophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(2,4-dichlorophenyl)-3-(2-fluorophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5129440 |
| Molecular Formula | C15H10Cl2FNOS |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-(2-fluorophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(Cl)cc2Cl)N1c1ccccc1F |
| InChI | InChI=1S/C15H10Cl2FNOS/c16-9-5-6-10(11(17)7-9)15-19(14(20)8-21-15)13-4-2-1-3-12(13)18/h1-7,15H,8H2 |
| InChIKey | HDVOROMQJQXBRM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |