C15H11ClFNOS — CID 27566764
(2R)-2-(2-chlorophenyl)-3-(4-fluorophenyl)-1,3-thiazolidin-4-one (PubChem CID 27566764) has the molecular formula C15H11ClFNOS and a molecular weight of 307.78 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-3-(4-fluorophenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2R)-2-(2-chlorophenyl)-3-(4-fluorophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 27566764 |
| Molecular Formula | C15H11ClFNOS |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-3-(4-fluorophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS[C@H](c2ccccc2Cl)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11ClFNOS/c16-13-4-2-1-3-12(13)15-18(14(19)9-20-15)11-7-5-10(17)6-8-11/h1-8,15H,9H2/t15-/m1/s1 |
| InChIKey | XJYLMYKDTUUHDF-OAHLLOKOSA-N |
| XLogP | 4.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |