C13H10FNOS2 — CID 4054922
3-(2-fluorophenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one (PubChem CID 4054922) has the molecular formula C13H10FNOS2 and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-fluorophenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4054922 |
| Molecular Formula | C13H10FNOS2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 3-(2-fluorophenyl)-2-thiophen-2-yl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cccs2)N1c1ccccc1F |
| InChI | InChI=1S/C13H10FNOS2/c14-9-4-1-2-5-10(9)15-12(16)8-18-13(15)11-6-3-7-17-11/h1-7,13H,8H2 |
| InChIKey | UGOSIZFABRZQOV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |