C13H9FN2O2S — CID 115285691
3-(2-fluorophenyl)-5-thiophen-2-ylimidazolidine-2,4-dione (PubChem CID 115285691) has the molecular formula C13H9FN2O2S and a molecular weight of 276.29 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-5-thiophen-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-(2-fluorophenyl)-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 115285691 |
| Molecular Formula | C13H9FN2O2S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-(2-fluorophenyl)-5-thiophen-2-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2cccs2)C(=O)N1c1ccccc1F |
| InChI | InChI=1S/C13H9FN2O2S/c14-8-4-1-2-5-9(8)16-12(17)11(15-13(16)18)10-6-3-7-19-10/h1-7,11H,(H,15,18) |
| InChIKey | AWKPLTDRNXYWCK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|