C13H8Cl2N2O2S — CID 115285707
3-(3,4-dichlorophenyl)-5-thiophen-2-ylimidazolidine-2,4-dione (PubChem CID 115285707) has the molecular formula C13H8Cl2N2O2S and a molecular weight of 327.19 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-thiophen-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-(3,4-dichlorophenyl)-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 115285707 |
| Molecular Formula | C13H8Cl2N2O2S |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-thiophen-2-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2cccs2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2N2O2S/c14-8-4-3-7(6-9(8)15)17-12(18)11(16-13(17)19)10-2-1-5-20-10/h1-6,11H,(H,16,19) |
| InChIKey | VLDRGVBQDMFRHA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|