C14H9N3O2S — CID 115285684
4-(2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)benzonitrile (PubChem CID 115285684) has the molecular formula C14H9N3O2S and a molecular weight of 283.31 g/mol. Its IUPAC name is 4-(2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)benzonitrile.
| Compound Name | 4-(2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 115285684 |
| Molecular Formula | C14H9N3O2S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 4-(2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(N2C(=O)NC(c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C14H9N3O2S/c15-8-9-3-5-10(6-4-9)17-13(18)12(16-14(17)19)11-2-1-7-20-11/h1-7,12H,(H,16,19) |
| InChIKey | WFDHTSSHMDJHCL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|