C23H26N2O2Si — CID 100966751
[6-methoxy-1-(2-methylphenyl)-2-trimethylsilylpyrrolo[3,2-c]quinolin-3-yl]methanol (PubChem CID 100966751) has the molecular formula C23H26N2O2Si and a molecular weight of 390.56 g/mol. Its IUPAC name is [6-methoxy-1-(2-methylphenyl)-2-trimethylsilylpyrrolo[3,2-c]quinolin-3-yl]methanol.
| Compound Name | [6-methoxy-1-(2-methylphenyl)-2-trimethylsilylpyrrolo[3,2-c]quinolin-3-yl]methanol |
|---|---|
| PubChem CID | 100966751 |
| Molecular Formula | C23H26N2O2Si |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [6-methoxy-1-(2-methylphenyl)-2-trimethylsilylpyrrolo[3,2-c]quinolin-3-yl]methanol |
| SMILES | COc1cccc2c1ncc1c(CO)c([Si](C)(C)C)n(-c3ccccc3C)c12 |
| InChI | InChI=1S/C23H26N2O2Si/c1-15-9-6-7-11-19(15)25-22-16-10-8-12-20(27-2)21(16)24-13-17(22)18(14-26)23(25)28(3,4)5/h6-13,26H,14H2,1-5H3 |
| InChIKey | RUDRMOLEJMCFAY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|