C24H28N2O2Si — CID 15420060
[6-methoxy-1-[(4-methoxyphenyl)methyl]-3-methylpyrrolo[3,2-c]quinolin-2-yl]-trimethylsilane (PubChem CID 15420060) has the molecular formula C24H28N2O2Si and a molecular weight of 404.59 g/mol. Its IUPAC name is [6-methoxy-1-[(4-methoxyphenyl)methyl]-3-methylpyrrolo[3,2-c]quinolin-2-yl]-trimethylsilane.
| Compound Name | [6-methoxy-1-[(4-methoxyphenyl)methyl]-3-methylpyrrolo[3,2-c]quinolin-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 15420060 |
| Molecular Formula | C24H28N2O2Si |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [6-methoxy-1-[(4-methoxyphenyl)methyl]-3-methylpyrrolo[3,2-c]quinolin-2-yl]-trimethylsilane |
| SMILES | COc1ccc(Cn2c([Si](C)(C)C)c(C)c3cnc4c(OC)cccc4c32)cc1 |
| InChI | InChI=1S/C24H28N2O2Si/c1-16-20-14-25-22-19(8-7-9-21(22)28-3)23(20)26(24(16)29(4,5)6)15-17-10-12-18(27-2)13-11-17/h7-14H,15H2,1-6H3 |
| InChIKey | YASGAOQZQKWFAW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|