C12H26O2Si — CID 100967271
(3S,4R)-3-[tert-butyl(dimethyl)silyl]-4-hydroxy-3-methylpentan-2-one (PubChem CID 100967271) has the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. Its IUPAC name is (3S,4R)-3-[tert-butyl(dimethyl)silyl]-4-hydroxy-3-methylpentan-2-one.
| Compound Name | (3S,4R)-3-[tert-butyl(dimethyl)silyl]-4-hydroxy-3-methylpentan-2-one |
|---|---|
| PubChem CID | 100967271 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (3S,4R)-3-[tert-butyl(dimethyl)silyl]-4-hydroxy-3-methylpentan-2-one |
| SMILES | CC(=O)[C@](C)([C@@H](C)O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26O2Si/c1-9(13)12(6,10(2)14)15(7,8)11(3,4)5/h9,13H,1-8H3/t9-,12+/m1/s1 |
| InChIKey | JNZYHZUBWNJAHO-SKDRFNHKSA-N |
| XLogP | 3.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|