C15H28O — CID 166508440
(Z)-3,3,4,5,6,6,7-heptamethyloct-4-en-2-one (PubChem CID 166508440) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is (Z)-3,3,4,5,6,6,7-heptamethyloct-4-en-2-one.
| Compound Name | (Z)-3,3,4,5,6,6,7-heptamethyloct-4-en-2-one |
|---|---|
| PubChem CID | 166508440 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | (Z)-3,3,4,5,6,6,7-heptamethyloct-4-en-2-one |
| SMILES | CC(=O)C(C)(C)/C(C)=C(/C)C(C)(C)C(C)C |
| InChI | InChI=1S/C15H28O/c1-10(2)14(6,7)11(3)12(4)15(8,9)13(5)16/h10H,1-9H3/b12-11- |
| InChIKey | LWYJLNJPHCKZMV-QXMHVHEDSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|