C14H20 — CID 100967834
(E)-3,4-ditert-butylhex-3-en-1,5-diyne (PubChem CID 100967834) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (E)-3,4-ditert-butylhex-3-en-1,5-diyne.
| Compound Name | (E)-3,4-ditert-butylhex-3-en-1,5-diyne |
|---|---|
| PubChem CID | 100967834 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (E)-3,4-ditert-butylhex-3-en-1,5-diyne |
| SMILES | C#C/C(=C(/C#C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H20/c1-9-11(13(3,4)5)12(10-2)14(6,7)8/h1-2H,3-8H3/b12-11+ |
| InChIKey | AJMLJTJZAQGCOA-VAWYXSNFSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|