C10H12 — CID 13442495
(Z)-4,5-dimethyloct-4-en-1,7-diyne (PubChem CID 13442495) has the molecular formula C10H12 and a molecular weight of 132.21 g/mol. Its IUPAC name is (Z)-4,5-dimethyloct-4-en-1,7-diyne.
| Compound Name | (Z)-4,5-dimethyloct-4-en-1,7-diyne |
|---|---|
| PubChem CID | 13442495 |
| Molecular Formula | C10H12 |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (Z)-4,5-dimethyloct-4-en-1,7-diyne |
| SMILES | C#CC/C(C)=C(/C)CC#C |
| InChI | InChI=1S/C10H12/c1-5-7-9(3)10(4)8-6-2/h1-2H,7-8H2,3-4H3/b10-9- |
| InChIKey | SPKLPXSVMKEAHT-KTKRTIGZSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|