C10H14 — CID 14496262
(3Z)-3,7-dimethylocta-3,6-dien-1-yne (PubChem CID 14496262) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (3Z)-3,7-dimethylocta-3,6-dien-1-yne.
| Compound Name | (3Z)-3,7-dimethylocta-3,6-dien-1-yne |
|---|---|
| PubChem CID | 14496262 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (3Z)-3,7-dimethylocta-3,6-dien-1-yne |
| SMILES | C#C/C(C)=C\CC=C(C)C |
| InChI | InChI=1S/C10H14/c1-5-10(4)8-6-7-9(2)3/h1,7-8H,6H2,2-4H3/b10-8- |
| InChIKey | AJUDLCRYEGKSIL-NTMALXAHSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|