C10H13F — CID 134992749
(5Z)-8-fluoro-2,5-dimethylocta-1,5-dien-3-yne (PubChem CID 134992749) has the molecular formula C10H13F and a molecular weight of 152.21 g/mol. Its IUPAC name is (5Z)-8-fluoro-2,5-dimethylocta-1,5-dien-3-yne.
| Compound Name | (5Z)-8-fluoro-2,5-dimethylocta-1,5-dien-3-yne |
|---|---|
| PubChem CID | 134992749 |
| Molecular Formula | C10H13F |
| Molecular Weight | 152.21 g/mol |
| Exact Mass | 152.10 |
| IUPAC Name | (5Z)-8-fluoro-2,5-dimethylocta-1,5-dien-3-yne |
| SMILES | C=C(C)C#C/C(C)=C\CCF |
| InChI | InChI=1S/C10H13F/c1-9(2)6-7-10(3)5-4-8-11/h5H,1,4,8H2,2-3H3/b10-5- |
| InChIKey | PHXZRAWSCZLWNK-YHYXMXQVSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|