About (Z)-3,5-dimethylhex-3-en-1-yne
(Z)-3,5-dimethylhex-3-en-1-yne (PubChem CID 15357563) has the molecular formula C8H12
and a molecular weight of 108.18 g/mol. Its IUPAC name is (Z)-3,5-dimethylhex-3-en-1-yne.
Molecular Properties
| Compound Name | (Z)-3,5-dimethylhex-3-en-1-yne |
| PubChem CID | 15357563 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | (Z)-3,5-dimethylhex-3-en-1-yne |
| SMILES | C#C/C(C)=C\C(C)C |
| InChI | InChI=1S/C8H12/c1-5-8(4)6-7(2)3/h1,6-7H,2-4H3/b8-6- |
| InChIKey | HMVBQEAJQVQOTI-VURMDHGXSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,5-dimethylhex-3-en-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,5-dimethylhex-3-en-1-yne?
The IUPAC name of (Z)-3,5-dimethylhex-3-en-1-yne (CID 15357563) is (Z)-3,5-dimethylhex-3-en-1-yne.
What is the SMILES notation for (Z)-3,5-dimethylhex-3-en-1-yne?
The canonical SMILES for (Z)-3,5-dimethylhex-3-en-1-yne is C#C/C(C)=C\C(C)C.
What is the InChIKey of (Z)-3,5-dimethylhex-3-en-1-yne?
The InChIKey is HMVBQEAJQVQOTI-VURMDHGXSA-N. The full InChI is InChI=1S/C8H12/c1-5-8(4)6-7(2)3/h1,6-7H,2-4H3/b8-6-.
What are the key properties of (Z)-3,5-dimethylhex-3-en-1-yne?
(Z)-3,5-dimethylhex-3-en-1-yne has a molecular weight of 108.18 g/mol, XLogP of 2.22, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,5-dimethylhex-3-en-1-yne is sourced from PubChem (CID 15357563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).