C22H25NO4 — CID 100968491
(3R,7R,8aR)-3-phenyl-7-[(2R)-1-phenylmethoxypropan-2-yl]-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-c][1,3]oxazin-5-one (PubChem CID 100968491) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is (3R,7R,8aR)-3-phenyl-7-[(2R)-1-phenylmethoxypropan-2-yl]-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-c][1,3]oxazin-5-one.
| Compound Name | (3R,7R,8aR)-3-phenyl-7-[(2R)-1-phenylmethoxypropan-2-yl]-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-c][1,3]oxazin-5-one |
|---|---|
| PubChem CID | 100968491 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (3R,7R,8aR)-3-phenyl-7-[(2R)-1-phenylmethoxypropan-2-yl]-3,7,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-c][1,3]oxazin-5-one |
| SMILES | C[C@H](COCc1ccccc1)[C@H]1C[C@H]2OC[C@@H](c3ccccc3)N2C(=O)O1 |
| InChI | InChI=1S/C22H25NO4/c1-16(13-25-14-17-8-4-2-5-9-17)20-12-21-23(22(24)27-20)19(15-26-21)18-10-6-3-7-11-18/h2-11,16,19-21H,12-15H2,1H3/t16-,19+,20-,21-/m1/s1 |
| InChIKey | UHPCSEVQHLLDBA-UMSONDCASA-N |
| XLogP | 4.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |