C19H26O5 — CID 10892992
(2S,3aR,6R,7aR)-2-methoxy-2-methyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-3a,6,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-one (PubChem CID 10892992) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (2S,3aR,6R,7aR)-2-methoxy-2-methyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-3a,6,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-one.
| Compound Name | (2S,3aR,6R,7aR)-2-methoxy-2-methyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-3a,6,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-one |
|---|---|
| PubChem CID | 10892992 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (2S,3aR,6R,7aR)-2-methoxy-2-methyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-3a,6,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-one |
| SMILES | CO[C@]1(C)C[C@H]2C(=O)O[C@@H]([C@@H](C)COCc3ccccc3)C[C@H]2O1 |
| InChI | InChI=1S/C19H26O5/c1-13(11-22-12-14-7-5-4-6-8-14)16-9-17-15(18(20)23-16)10-19(2,21-3)24-17/h4-8,13,15-17H,9-12H2,1-3H3/t13-,15+,16+,17+,19-/m0/s1 |
| InChIKey | YWRWLLCPMIYAOM-AUIAMIIESA-N |
| XLogP | 2.92 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |