C20H28O5 — CID 10980960
(2S,3aR,6S,7R,7aR)-2-methoxy-2,7-dimethyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-3a,6,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-one (PubChem CID 10980960) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (2S,3aR,6S,7R,7aR)-2-methoxy-2,7-dimethyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-3a,6,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-one.
| Compound Name | (2S,3aR,6S,7R,7aR)-2-methoxy-2,7-dimethyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-3a,6,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-one |
|---|---|
| PubChem CID | 10980960 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (2S,3aR,6S,7R,7aR)-2-methoxy-2,7-dimethyl-6-[(2R)-1-phenylmethoxypropan-2-yl]-3a,6,7,7a-tetrahydro-3H-furo[3,2-c]pyran-4-one |
| SMILES | CO[C@]1(C)C[C@H]2C(=O)O[C@@H]([C@H](C)COCc3ccccc3)[C@H](C)[C@H]2O1 |
| InChI | InChI=1S/C20H28O5/c1-13(11-23-12-15-8-6-5-7-9-15)17-14(2)18-16(19(21)24-17)10-20(3,22-4)25-18/h5-9,13-14,16-18H,10-12H2,1-4H3/t13-,14+,16-,17+,18-,20+/m1/s1 |
| InChIKey | JCQQHOKRUSJLED-VCVLNCAMSA-N |
| XLogP | 3.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |