C24H29N3O6S — CID 10096964
2-[[4-[[3-butyl-5-(2-hydroxyethoxy)-1-methylpyrazol-4-yl]methyl]phenyl]carbamoyl]benzenesulfonic acid (PubChem CID 10096964) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is 2-[[4-[[3-butyl-5-(2-hydroxyethoxy)-1-methylpyrazol-4-yl]methyl]phenyl]carbamoyl]benzenesulfonic acid.
| Compound Name | 2-[[4-[[3-butyl-5-(2-hydroxyethoxy)-1-methylpyrazol-4-yl]methyl]phenyl]carbamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 10096964 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[[4-[[3-butyl-5-(2-hydroxyethoxy)-1-methylpyrazol-4-yl]methyl]phenyl]carbamoyl]benzenesulfonic acid |
| SMILES | CCCCc1nn(C)c(OCCO)c1Cc1ccc(NC(=O)c2ccccc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C24H29N3O6S/c1-3-4-8-21-20(24(27(2)26-21)33-15-14-28)16-17-10-12-18(13-11-17)25-23(29)19-7-5-6-9-22(19)34(30,31)32/h5-7,9-13,28H,3-4,8,14-16H2,1-2H3,(H,25,29)(H,30,31,32) |
| InChIKey | XSNUBOMXCOLGOO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|