C20H17N3O4S — CID 4144466
2-[[4-[(4-methylphenyl)diazenyl]phenyl]carbamoyl]benzenesulfonic acid (PubChem CID 4144466) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-[[4-[(4-methylphenyl)diazenyl]phenyl]carbamoyl]benzenesulfonic acid.
| Compound Name | 2-[[4-[(4-methylphenyl)diazenyl]phenyl]carbamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 4144466 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[[4-[(4-methylphenyl)diazenyl]phenyl]carbamoyl]benzenesulfonic acid |
| SMILES | Cc1ccc(/N=N/c2ccc(NC(=O)c3ccccc3S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H17N3O4S/c1-14-6-8-16(9-7-14)22-23-17-12-10-15(11-13-17)21-20(24)18-4-2-3-5-19(18)28(25,26)27/h2-13H,1H3,(H,21,24)(H,25,26,27)/b23-22+ |
| InChIKey | JPKAEFVGMSPZLZ-GHVJWSGMSA-N |
| XLogP | 4.91 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|