C22H34O5 — CID 100969927
[(2R,4S,6R)-6-hexyl-2-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl] acetate (PubChem CID 100969927) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(2R,4S,6R)-6-hexyl-2-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl] acetate.
| Compound Name | [(2R,4S,6R)-6-hexyl-2-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl] acetate |
|---|---|
| PubChem CID | 100969927 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(2R,4S,6R)-6-hexyl-2-(3-phenylmethoxypropyl)-1,3-dioxan-4-yl] acetate |
| SMILES | CCCCCC[C@@H]1C[C@H](OC(C)=O)O[C@H](CCCOCc2ccccc2)O1 |
| InChI | InChI=1S/C22H34O5/c1-3-4-5-9-13-20-16-22(25-18(2)23)27-21(26-20)14-10-15-24-17-19-11-7-6-8-12-19/h6-8,11-12,20-22H,3-5,9-10,13-17H2,1-2H3/t20-,21-,22-/m1/s1 |
| InChIKey | ZTJDHDCIZWTCBC-YPAWHYETSA-N |
| XLogP | 4.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|