C9H14O2 — CID 100970697
(9aS)-3,4,4a,8,9,9a-hexahydro-2H-pyrano[3,2-b]oxepine (PubChem CID 100970697) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (9aS)-3,4,4a,8,9,9a-hexahydro-2H-pyrano[3,2-b]oxepine.
| Compound Name | (9aS)-3,4,4a,8,9,9a-hexahydro-2H-pyrano[3,2-b]oxepine |
|---|---|
| PubChem CID | 100970697 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (9aS)-3,4,4a,8,9,9a-hexahydro-2H-pyrano[3,2-b]oxepine |
| SMILES | C1=COC2CCCO[C@H]2CC1 |
| InChI | InChI=1S/C9H14O2/c1-2-6-10-9-5-3-7-11-8(9)4-1/h2,6,8-9H,1,3-5,7H2/t8-,9?/m0/s1 |
| InChIKey | XNNJYUXAHZMYAV-IENPIDJESA-N |
| XLogP | 1.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |