C10H16O2 — CID 66685474
2-(oxan-2-yl)-3,4-dihydro-2H-pyran (PubChem CID 66685474) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(oxan-2-yl)-3,4-dihydro-2H-pyran.
| Compound Name | 2-(oxan-2-yl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 66685474 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-(oxan-2-yl)-3,4-dihydro-2H-pyran |
| SMILES | C1=COC(C2CCCCO2)CC1 |
| InChI | InChI=1S/C10H16O2/c1-3-7-11-9(5-1)10-6-2-4-8-12-10/h3,7,9-10H,1-2,4-6,8H2 |
| InChIKey | YRGRJVDIBAGBGE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |