C31H53N3O4 — CID 100971947
(2S)-N-[(2S)-1-[(5-hydroxy-2-methylundecan-4-yl)amino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(3-phenylpropanoylamino)butanamide (PubChem CID 100971947) has the molecular formula C31H53N3O4 and a molecular weight of 531.78 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[(5-hydroxy-2-methylundecan-4-yl)amino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(3-phenylpropanoylamino)butanamide.
| Compound Name | (2S)-N-[(2S)-1-[(5-hydroxy-2-methylundecan-4-yl)amino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(3-phenylpropanoylamino)butanamide |
|---|---|
| PubChem CID | 100971947 |
| Molecular Formula | C31H53N3O4 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.40 |
| IUPAC Name | (2S)-N-[(2S)-1-[(5-hydroxy-2-methylundecan-4-yl)amino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(3-phenylpropanoylamino)butanamide |
| SMILES | CCCCCCC(O)C(CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CCc1ccccc1)C(C)C)C(C)C |
| InChI | InChI=1S/C31H53N3O4/c1-8-9-10-14-17-26(35)25(20-21(2)3)32-30(37)29(23(6)7)34-31(38)28(22(4)5)33-27(36)19-18-24-15-12-11-13-16-24/h11-13,15-16,21-23,25-26,28-29,35H,8-10,14,17-20H2,1-7H3,(H,32,37)(H,33,36)(H,34,38)/t25?,26?,28-,29-/m0/s1 |
| InChIKey | WLTRQKQPNCESRC-MDQKUIDESA-N |
| XLogP | 4.76 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|