C11H13N3O5S — CID 100974963
2-[(2R)-3-amino-2-(methylamino)-3-oxopropyl]sulfanyl-4-nitrobenzoic acid (PubChem CID 100974963) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-[(2R)-3-amino-2-(methylamino)-3-oxopropyl]sulfanyl-4-nitrobenzoic acid.
| Compound Name | 2-[(2R)-3-amino-2-(methylamino)-3-oxopropyl]sulfanyl-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 100974963 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-[(2R)-3-amino-2-(methylamino)-3-oxopropyl]sulfanyl-4-nitrobenzoic acid |
| SMILES | CN[C@@H](CSc1cc([N+](=O)[O-])ccc1C(=O)O)C(N)=O |
| InChI | InChI=1S/C11H13N3O5S/c1-13-8(10(12)15)5-20-9-4-6(14(18)19)2-3-7(9)11(16)17/h2-4,8,13H,5H2,1H3,(H2,12,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | CYPALGBUNDSKKR-QMMMGPOBSA-N |
| XLogP | 0.46 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|